1-Propanol,2-[[(2,4-dimethoxyphenyl)methyl]amino]-2-methyl- structure
|
Common Name | 1-Propanol,2-[[(2,4-dimethoxyphenyl)methyl]amino]-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 25452-32-8 | Molecular Weight | 239.31100 | |
| Density | 1.058g/cm3 | Boiling Point | 375.5ºC at 760 mmHg | |
| Molecular Formula | C13H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.9ºC | |
| Name | 2-[(2,4-dimethoxyphenyl)methylamino]-2-methylpropan-1-ol |
|---|
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 375.5ºC at 760 mmHg |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31100 |
| Flash Point | 180.9ºC |
| Exact Mass | 239.15200 |
| PSA | 50.72000 |
| LogP | 1.95520 |
| Vapour Pressure | 2.63E-06mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | VPOSPMLMNYGJRG-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNC(C)(C)CO)c(OC)c1 |
|
~%
1-Propanol,2-[[... CAS#:25452-32-8 |
| Literature: Billman; Koehler; May Journal of pharmaceutical sciences, 1969 , vol. 58, # 6 p. 767 - 769 |
|
~%
1-Propanol,2-[[... CAS#:25452-32-8 |
| Literature: Billman; Koehler; May Journal of pharmaceutical sciences, 1969 , vol. 58, # 6 p. 767 - 769 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |