1-Propanol,2-[[(2,4-dimethoxyphenyl)methylene]amino]-2-methyl- structure
|
Common Name | 1-Propanol,2-[[(2,4-dimethoxyphenyl)methylene]amino]-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 25458-08-6 | Molecular Weight | 237.29500 | |
| Density | 1.03g/cm3 | Boiling Point | 372ºC at 760mmHg | |
| Molecular Formula | C13H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.8ºC | |
| Name | 2-[(2,4-dimethoxyphenyl)methylideneamino]-2-methylpropan-1-ol |
|---|
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 372ºC at 760mmHg |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.29500 |
| Flash Point | 178.8ºC |
| Exact Mass | 237.13600 |
| PSA | 51.05000 |
| LogP | 1.89360 |
| Vapour Pressure | 3.41E-06mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | AUJYUXZAGPEFMQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=NC(C)(C)CO)c(OC)c1 |
|
~%
1-Propanol,2-[[... CAS#:25458-08-6 |
| Literature: Billman; Koehler; May Journal of pharmaceutical sciences, 1969 , vol. 58, # 6 p. 767 - 769 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |