N,N'-Dinitro-N,N'-dimethylurea structure
|
Common Name | N,N'-Dinitro-N,N'-dimethylurea | ||
|---|---|---|---|---|
| CAS Number | 25466-50-6 | Molecular Weight | 178.10400 | |
| Density | 1.545g/cm3 | Boiling Point | 300.6ºC at 760 mmHg | |
| Molecular Formula | C3H6N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.6ºC | |
| Name | 1,3-dimethyl-1,3-dinitrourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.545g/cm3 |
|---|---|
| Boiling Point | 300.6ºC at 760 mmHg |
| Molecular Formula | C3H6N4O5 |
| Molecular Weight | 178.10400 |
| Flash Point | 135.6ºC |
| Exact Mass | 178.03400 |
| PSA | 115.19000 |
| LogP | 0.39980 |
| Vapour Pressure | 0.00111mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | FEQAJOCLTADZKX-UHFFFAOYSA-N |
| SMILES | CN(C(=O)N(C)[N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Dimethyl-N,N'-dinitrourea |
| 1,3-Dimethyl-1,3-dinitro-harnstoff |