4-methoxybenzyloxycarbonyl azide structure
|
Common Name | 4-methoxybenzyloxycarbonyl azide | ||
|---|---|---|---|---|
| CAS Number | 25474-85-5 | Molecular Weight | 207.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O3 | Melting Point | 30-32ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS03, GHS07 |
Signal Word | Danger | |
| Name | (4-methoxyphenyl)methyl N-diazocarbamate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 30-32ºC(lit.) |
|---|---|
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.18600 |
| Flash Point | >230 °F |
| Exact Mass | 207.06400 |
| PSA | 85.28000 |
| LogP | 2.09486 |
| InChIKey | NQBRFIXRZDTIRQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)N=[N+]=[N-])cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS03, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H272-H302 + H312 + H332 |
| Precautionary Statements | P220-P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R5 |
| Safety Phrases | S24/25 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 3 |
| HS Code | 2927000090 |
|
~%
4-methoxybenzyl... CAS#:25474-85-5 |
| Literature: Chemische Berichte, , vol. 95, p. 1 - 6 |
|
~%
4-methoxybenzyl... CAS#:25474-85-5 |
| Literature: Chemische Berichte, , vol. 95, p. 1 - 6 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Synthesis of tritium-labelled isopenicillin N, penicillin N and 6-aminopenicillanic acid.
Biochem. J. 151(3) , 729-39, (1975) 1. Phenoxymethylpenicillin sulphoxide 4-methoxybenzyl ester was labelled with 3H in its 2-beta-methyl group. Its specific radioactivity was 362 mCi/mmol. 2. Removal of the side chain of this compound ... |
| EINECS 247-017-1 |
| p-methoxy-carbobenzoxy azide |
| 4-methoxy-benzyloxycarbonyl azide |
| (p-methoxyphenyl)methoxycarbonylazide |
| [(p-methoxybenzyl)oxy]carbonylazide |
| MFCD00001988 |
| 4-methoxybenzyl carbonazidate |
| 4-methoxybenzyl azidoformate |
| [(4-Methoxyphenyl)methoxy]carbonylazide |
| p-Methoxybenzylazidoformate |