Vitamin K1 2,3-Oxide structure
|
Common Name | Vitamin K1 2,3-Oxide | ||
|---|---|---|---|---|
| CAS Number | 25486-55-9 | Molecular Weight | 466.695 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 561.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C31H46O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.8±30.2 °C | |
| Name | vitamin K epoxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.1±50.0 °C at 760 mmHg |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.695 |
| Flash Point | 233.8±30.2 °C |
| Exact Mass | 466.344696 |
| PSA | 46.67000 |
| LogP | 11.33 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | KUTXFBIHPWIDJQ-LKUDQCMESA-N |
| SMILES | CC(=CCC12OC1(C)C(=O)c1ccccc1C2=O)CCCC(C)CCCC(C)CCCC(C)C |
|
~28%
Vitamin K1 2,3-Oxide CAS#:25486-55-9 |
| Literature: Colonna; Manfredi; Annuziata; Gaggero; Casella Journal of Organic Chemistry, 1990 , vol. 55, # 23 p. 5862 - 5866 |
|
~%
Vitamin K1 2,3-Oxide CAS#:25486-55-9 |
| Literature: Journal of the American Chemical Society, , vol. 115, # 21 p. 9409 - 9416 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl-7a-[(2E)-3,7,11,15-tetramethyl-2-hexadecen-1-yl]- |
| 1a-Methyl-7a-[(2E)-3,7,11,15-tetramethylhexadec-2-en-1-yl]-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
| vitamin K1-2,3-<16>O-epoxide |
| vitamin K oxide |
| (2,3-epoxyphytyl)menaquinone |
| Vitamin K1 2,3-Oxide |
| Vitamin K1 2,3-epoxide |
| 1a,7a-Dihydro-7a-methyl-1a-(3,7,11,15-tetramethyl-2-hexadecenyl)naphth[2,3-b]oxirene-2,7-dione |
| 2-Methyl-3-phytyl-2,3-epoxy-2,3-dihydro-1,4-naphthoquinone |
| 1a-Methyl-7a-[(2E)-3,7,11,15-tetramethyl-2-hexadecen-1-yl]-1a,7a-dihydronaphtho[2,3-b]oxirene-2,7-dione |
| 3-Phenyl-2-methyl-thiophen |
| Naphth[2,3-b]oxirene-2,7-dione, 1a,7a-dihydro-1a-methyl-7a-(3,7,11,15-tetramethyl-2-hexadecenyl)- |
| Vitamin K 2,3-epoxide |
| 2-Methyl-3-phenyl-thiophen |
| 2-methyl-3-phenyl-thiophene |
| 2-Methyl-3-phytyl-1,4-naphthoquinone 2,3-Oxide |
| (E)-vitamin K oxide |