4-(Allyloxy)-2-hydroxybenzophenone structure
|
Common Name | 4-(Allyloxy)-2-hydroxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 2549-87-3 | Molecular Weight | 254.281 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 403.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 67-70ºC | |
| MSDS | Chinese USA | Flash Point | 148.9±19.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2-hydroxy-4-prop-2-enoxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.0±35.0 °C at 760 mmHg |
| Melting Point | 67-70ºC |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.281 |
| Flash Point | 148.9±19.4 °C |
| Exact Mass | 254.094299 |
| PSA | 46.53000 |
| LogP | 4.45 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | GVZIBGFELWPEOC-UHFFFAOYSA-N |
| SMILES | C=CCOc1ccc(C(=O)c2ccccc2)c(O)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914509090 |
|
~%
4-(Allyloxy)-2-... CAS#:2549-87-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 48, # 26 p. 8194 - 8208 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Hydroxy-4-allyloxybenzophenon |
| MFCD00191713 |
| (4-(Allyloxy)-2-hydroxyphenyl)(phenyl)methanone |
| 4-ALLYLOXY-2-HYDROXYBENZOPHENONE |
| 4-(Allyloxy)-2-hydroxybenzophenone |
| Methanone, (2-hydroxy-4-(2-propenyloxy)phenyl)phenyl- |
| Methanone, [2-hydroxy-4-(2-propen-1-yloxy)phenyl]phenyl- |
| 2-hydroxy-4-prop-2-enyloxyphenyl phenyl ketone |
| [4-(Allyloxy)-2-hydroxyphenyl](phenyl)methanone |