2-(3-phenylpropyl)guanidine,sulfuric acid
Modify Date: 2025-08-29 10:53:51
2-(3-phenylpropyl)guanidine,sulfuric acid structure
|
Common Name | 2-(3-phenylpropyl)guanidine,sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 2551-71-5 | Molecular Weight | 275.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-phenylpropyl)guanidine,sulfuric acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H17N3O4S |
|---|---|
| Molecular Weight | 275.32500 |
| Exact Mass | 275.09400 |
| PSA | 144.88000 |
| LogP | 2.72120 |
| InChIKey | AFKGADHIDKMXRU-UHFFFAOYSA-N |
| SMILES | NC(N)=NCCCc1ccccc1.NC(N)=NCCCc1ccccc1.O=S(=O)(O)O |
|
~%
2-(3-phenylprop... CAS#:2551-71-5 |
| Literature: Braun; Randall Journal of the American Chemical Society, 1934 , vol. 56, p. 2134 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3-Phenyl-propyl)-guanidin,Sulfat |
| (3-phenyl-propyl)-guanidine,sulfate |