2-(3-Dimethylaminopropyl)guanidine; sulfuric acid structure
|
Common Name | 2-(3-Dimethylaminopropyl)guanidine; sulfuric acid | ||
|---|---|---|---|---|
| CAS Number | 4603-23-0 | Molecular Weight | 242.29700 | |
| Density | N/A | Boiling Point | 250.6ºC at 760 mmHg | |
| Molecular Formula | C6H18N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 105.3ºC | |
| Name | 2-[3-(dimethylamino)propyl]guanidine,sulfuric acid |
|---|
| Boiling Point | 250.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H18N4O4S |
| Molecular Weight | 242.29700 |
| Flash Point | 105.3ºC |
| Exact Mass | 242.10500 |
| PSA | 148.12000 |
| LogP | 1.04010 |
| InChIKey | PFSBRVAUQQQEMA-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN=C(N)N.O=S(=O)(O)O |
| HS Code | 2925290090 |
|---|
|
~40%
2-(3-Dimethylam... CAS#:4603-23-0 |
| Literature: Sterk; Van der Goot; Timmerman European Journal of Medicinal Chemistry, 1984 , vol. 19, # 6 p. 545 - 550 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |