2H-1-Benzopyran-2-one,3-(4-nitrophenyl) structure
|
Common Name | 2H-1-Benzopyran-2-one,3-(4-nitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 2555-25-1 | Molecular Weight | 267.23600 | |
| Density | 1.398g/cm3 | Boiling Point | 484.9ºC at 760 mmHg | |
| Molecular Formula | C15H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.6ºC | |
| Name | 3-(4-nitrophenyl)chromen-2-one |
|---|
| Density | 1.398g/cm3 |
|---|---|
| Boiling Point | 484.9ºC at 760 mmHg |
| Molecular Formula | C15H9NO4 |
| Molecular Weight | 267.23600 |
| Flash Point | 228.6ºC |
| Exact Mass | 267.05300 |
| PSA | 76.03000 |
| LogP | 3.89140 |
| Vapour Pressure | 1.48E-09mmHg at 25°C |
| Index of Refraction | 1.662 |
| InChIKey | GATDYELJYSMQPH-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccccc2cc1-c1ccc([N+](=O)[O-])cc1 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
|
Name: Binding affinity to corpus collosum myelin in central nervous system of mouse at 100 ...
Source: ChEMBL
Target: Myelin basic protein
External Id: CHEMBL1767433
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|