Ethyl 2-(4-nitrophenyl)acetate structure
|
Common Name | Ethyl 2-(4-nitrophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 5445-26-1 | Molecular Weight | 209.199 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 322.2±17.0 °C at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | 61-65 °C | |
| MSDS | N/A | Flash Point | 144.1±22.9 °C | |
| Name | Ethyl 4-Nitrophenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 322.2±17.0 °C at 760 mmHg |
| Melting Point | 61-65 °C |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.199 |
| Flash Point | 144.1±22.9 °C |
| Exact Mass | 209.068802 |
| PSA | 72.12000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | DWDRNKYLWMKWTH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc([N+](=O)[O-])cc1 |
| Storage condition | Refrigerator |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| MFCD00017046 |
| Ethyl (4-nitrophenyl)acetate |
| Acetic acid, (p-nitrophenyl)-, ethyl ester |
| Ethyl 4-nitrobenzeneacetate |
| ethyl 2-(4-nitrophenyl)acetate |
| EINECS 226-646-5 |
| Ethyl 4-nitrophenylacetate |
| Benzeneacetic acid, 4-nitro-, ethyl ester |
| Ethyl p-nitrophenylacetate |