2-(4-Chlorophenoxy)phenylacetic acid structure
|
Common Name | 2-(4-Chlorophenoxy)phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 25563-04-6 | Molecular Weight | 262.68800 | |
| Density | 1.317 g/cm3 | Boiling Point | 397.7ºC at 760 mmHg | |
| Molecular Formula | C14H11ClO3 | Melting Point | 120-122ºC | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | 2-[2-(4-chlorophenoxy)phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317 g/cm3 |
|---|---|
| Boiling Point | 397.7ºC at 760 mmHg |
| Melting Point | 120-122ºC |
| Molecular Formula | C14H11ClO3 |
| Molecular Weight | 262.68800 |
| Flash Point | 194.3ºC |
| Exact Mass | 262.04000 |
| PSA | 46.53000 |
| LogP | 3.75940 |
| InChIKey | ALMJMOPIBISVHZ-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1ccccc1Oc1ccc(Cl)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(4-Chlorphenyloxy)-phenylessigsaeure |
| 2-(4-Chlor-phenoxy)-phenylessigsaeure |
| 2-(4-chlorophenoxy)-benzeneacetic acid |
| 2-(2-(4-Chlorophenoxy)phenyl)acetic acid |
| o-(p-chlorophenoxy)phenylacetic acid |
| [2-(4-chloro-phenoxy)-phenyl]-acetic acid |