2-(4-chlorophenoxy)benzoic acid
2-(4-chlorophenoxy)benzoic acid structure
|
Common Name | 2-(4-chlorophenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6410-65-7 | Molecular Weight | 248.66200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-(4-Chlorophenoxy)benzoic acid (Chinese name: 2-(4-氯苯氧基)苯甲酸，CAS number: 6410-65-7) is an organic compound with molecular formula C13H9ClO3 and molecular weight 248.66200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-chloro-phenoxy)-benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9ClO3 |
|---|---|
| Molecular Weight | 248.66200 |
| Exact Mass | 248.02400 |
| PSA | 46.53000 |
| LogP | 3.83050 |
| InChIKey | KPENLTXCDFOSOO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Oc1ccc(Cl)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:25563-04-6
CAS#:13210-15-6
CAS#:51230-49-0This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Dissociation constant for HCV NS3 protease substrate binding site
Source: ChEMBL
Target: Genome polyprotein
External Id: CHEMBL751815
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-(4-chlorophenoxy)benzoic acid |
| 2-[4-Chlor-phenoxy]-benzoesaeure |
| 2-carboxy-4'-chloro-diphenylether |
| 2-(4'-chlorophenoxy)benzoic acid |
| 2-(p-Chlorphenoxy)benzoesaeure |
| 2-(4-Chlor-phenoxy)-benzoesaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 2-(4-chloro-phenoxy)-benzoic acid? |
| A: Related downstream products(CAS) of 2-(4-chloro-phenoxy)-benzoic acid: 25563-04-6;13210-15-6;51230-49-0. |
| Q: What is the LogP of 2-(4-chloro-phenoxy)-benzoic acid? |
| A: LogP of 2-(4-chloro-phenoxy)-benzoic acid is 3.83050. |
| Q: What is the polar surface area (PSA) of 2-(4-chloro-phenoxy)-benzoic acid? |
| A: Polar surface area (PSA) of 2-(4-chloro-phenoxy)-benzoic acid is 46.53000. |
| Q: What is the Chinese name of 6410-65-7? |
| A: Chinese name of 6410-65-7 is 6410-65-7. |
| Q: What is the InChIKey of 2-(4-chloro-phenoxy)-benzoic acid? |
| A: InChIKey of 2-(4-chloro-phenoxy)-benzoic acid is KPENLTXCDFOSOO-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(4-chloro-phenoxy)-benzoic acid? |
| A: The English name of 2-(4-chloro-phenoxy)-benzoic acid is 2-(4-chloro-phenoxy)-benzoic acid. |
| Q: What is the molecular weight of 2-(4-chloro-phenoxy)-benzoic acid? |
| A: Molecular weight of 2-(4-chloro-phenoxy)-benzoic acid is 248.66200. |
| Q: What English synonyms does 2-(4-chloro-phenoxy)-benzoic acid have? |
| A: English synonyms of 2-(4-chloro-phenoxy)-benzoic acid: 2-(4-chlorophenoxy)benzoic acid, 2-[4-Chlor-phenoxy]-benzoesaeure, 2-carboxy-4'-chloro-diphenylether, 2-(4'-chlorophenoxy)benzoic acid, 2-(p-Chlorphenoxy)benzoesaeure, 2-(4-Chlor-phenoxy)-benzoesaeure. |
| Q: What is the SMILES notation of 2-(4-chloro-phenoxy)-benzoic acid? |
| A: SMILES notation of 2-(4-chloro-phenoxy)-benzoic acid is O=C(O)c1ccccc1Oc1ccc(Cl)cc1. |
| Q: What is the molecular formula of 2-(4-chloro-phenoxy)-benzoic acid? |
| A: Molecular formula of 2-(4-chloro-phenoxy)-benzoic acid is C13H9ClO3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |