10-Undecenyl 2-bromoisobutyrate structure
|
Common Name | 10-Undecenyl 2-bromoisobutyrate | ||
|---|---|---|---|---|
| CAS Number | 255727-66-3 | Molecular Weight | 319.27800 | |
| Density | 1.080 g/cm3 at 25 °C | Boiling Point | 336.6±15.0 °C | |
| Molecular Formula | C15H27BrO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >110 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | undec-10-enyl 2-bromo-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.080 g/cm3 at 25 °C |
|---|---|
| Boiling Point | 336.6±15.0 °C |
| Molecular Formula | C15H27BrO2 |
| Molecular Weight | 319.27800 |
| Flash Point | >110 °C |
| Exact Mass | 318.11900 |
| PSA | 26.30000 |
| LogP | 5.00990 |
| InChIKey | RHLOSBPISIVGMQ-UHFFFAOYSA-N |
| SMILES | C=CCCCCCCCCCOC(=O)C(C)(C)Br |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Atom transfer radical polymerization.
Chem. Rev. 101 , 2921, (2001)
|
|
|
"Green" atom transfer radical polymerization: from process design to preparation of well-defined environmentally friendly polymeric materials.
Chem. Rev. 107 , 2270, (2007)
|
|
|
Coessens, V.; Pintauer, T.; Matyjaszewski, K.
Prog. Polym. Sci. 26 , 337, (2001)
|
| 10-Undecenyl 2-bromoisobutyrate |
| 10-undecen-1-yl 2-bromo-2-methylpropionate |
| Allyl-type (long chain) initiator |
| undec-10-en-1-yl 2-bromo-2-methylpropanoate |