Butyrylcarnitine structure
|
Common Name | Butyrylcarnitine | ||
|---|---|---|---|---|
| CAS Number | 25576-40-3 | Molecular Weight | 231.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ButyrylcarnitineButyrylcarnitine is a metabolite in plasma, acts as a biomarker to improve the diagnosis and prognosis of heart failure, and is indicative of anomalous lipid and energy metabolism. |
| Name | O-butanoyl-L-carnitine |
|---|---|
| Synonym | More Synonyms |
| Description | Butyrylcarnitine is a metabolite in plasma, acts as a biomarker to improve the diagnosis and prognosis of heart failure, and is indicative of anomalous lipid and energy metabolism. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Molecular Formula | C11H21NO4 |
|---|---|
| Molecular Weight | 231.28900 |
| Exact Mass | 231.14700 |
| PSA | 66.43000 |
| InChIKey | QWYFHHGCZUCMBN-SECBINFHSA-N |
| SMILES | CCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| n-butyrylcarnitine |
| Butyrylcarnitine |
| Butyryl-L-carnitine |
| (3r)-3-(butanoyloxy)-4-(trimethylammonio)butanoate |
| n-Butyryl-L-(-)-carnitin [German] |
| O-butanoyl-carnitine |
| O-n-Butyroylcarnitin |
| Ammonium,(3-carboxy-2-hydroxypropyl)trimethyl-,hydroxide,inner salt,butyrate,L |
| L-Carnitine butyryl ester |
| (3R)-3-butanoyloxy-4-(trimethylazaniumyl)butanoate |
| O-n-Butyryl-carnitin |
| n-Butyryl-l-Carnitin |
| n-butyryl-L-carnitine |