Adenylyl Imidodiphosphate structure
|
Common Name | Adenylyl Imidodiphosphate | ||
|---|---|---|---|---|
| CAS Number | 25612-73-1 | Molecular Weight | 506.19600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17N6O12P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Adenylyl ImidodiphosphateAMP-PNP (Adenylyl imidodiphosphate) is a non-hydrolysable ATP analogue[1]. |
| Name | amp-pnp |
|---|---|
| Synonym | More Synonyms |
| Description | AMP-PNP (Adenylyl imidodiphosphate) is a non-hydrolysable ATP analogue[1]. |
|---|---|
| Related Catalog | |
| In Vitro | AMP-PNP binding induces an inward rotation and shift of the transmembrane helices of LptFG and LptC to tighten the cavity, with the closure of two lateral gates, to eventually expel LPS into the bridge[1]. AMP-PNP significantly inhibits the ATPase activity of sfLptB2FGC, which was used to mimic and lock an ATP-bound state of sfLptB2FGC[1]. |
| References |
| Molecular Formula | C10H17N6O12P3 |
|---|---|
| Molecular Weight | 506.19600 |
| Exact Mass | 506.01200 |
| PSA | 311.36000 |
| InChIKey | PVKSNHVPLWYQGJ-KQYNXXCUSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)NP(=O)(O)O)C(O)C1O |
| Adenosine beta,gamma-imidotriphosphate |