4,5-Dichloro-2-thiophenesulfonamide structure
|
Common Name | 4,5-Dichloro-2-thiophenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 256353-34-1 | Molecular Weight | 232.108 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 405.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C4H3Cl2NO2S2 | Melting Point | 152-155ºC | |
| MSDS | Chinese USA | Flash Point | 198.9±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,5-dichlorothiophene-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 405.3±55.0 °C at 760 mmHg |
| Melting Point | 152-155ºC |
| Molecular Formula | C4H3Cl2NO2S2 |
| Molecular Weight | 232.108 |
| Flash Point | 198.9±31.5 °C |
| Exact Mass | 230.898224 |
| PSA | 96.78000 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | JKBNSTFOQDGQLS-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(Cl)c(Cl)s1 |
| Storage condition | 2-8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
|
~%
4,5-Dichloro-2-... CAS#:256353-34-1 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 2, p. 185,243,245 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2,3-Dichlorothiophene-5-sulfonamide |
| 2,3-Dichloro thiophene-5-sulfonamide |
| 4,5-dichloro-thiophene-2-sulfonic acid amide |
| T5SJ BG CG ESZW |
| 2,3-Dichlorthiophen-5-sulfamid |
| 4,5-Dichlorothiophene-2-sulfonamide |
| 4,5-Dichlor-thiophen-2-sulfonsaeure-amid |
| MFCD00177161 |
| 2,3,5-TRI-O-BENZYL-BETA-L-ARABINOFURANOSE |
| 2-Thiophenesulfonamide, 4,5-dichloro- |
| 4,5-Dichloro-2-thiophenesulfonamide |