Schleicheol 1 structure
|
Common Name | Schleicheol 1 | ||
|---|---|---|---|---|
| CAS Number | 256445-66-6 | Molecular Weight | 444.73 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 525.8±38.0 °C at 760 mmHg | |
| Molecular Formula | C30H52O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.4±21.0 °C | |
Use of Schleicheol 1Schleicheol 1 is a terpenoid that can be isolated from Secamone lanceolata[1]. |
| Name | 2-Methyl-4-[(2S)-2-oxiranylmethoxy]-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Description | Schleicheol 1 is a terpenoid that can be isolated from Secamone lanceolata[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 525.8±38.0 °C at 760 mmHg |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.73 |
| Flash Point | 207.4±21.0 °C |
| Exact Mass | 444.396729 |
| PSA | 29.46000 |
| LogP | 9.37 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | LJJLFLNKMQSUFO-XNXDZERNSA-N |
| SMILES | CCC(CCC(C)C1CCC2C3C(OC)C=C4CC(O)CCC4(C)C3CCC12C)C(C)C |
| Hazard Codes | Xi |
|---|
| Stigmast-5-en-3-ol, 7-methoxy-, (3β,7β)- |
| Stigmast-5-en-3-ol, 7-methoxy-, (3β)- |
| Schleicheol 1 |
| (3β,7β)-7-Methoxystigmast-5-en-3-ol |
| (3β)-7-Methoxystigmast-5-en-3-ol |