Cannabigerol structure
|
Common Name | Cannabigerol | ||
|---|---|---|---|---|
| CAS Number | 25654-31-3 | Molecular Weight | 316.478 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 470.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C21H32O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.2±21.9 °C | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
| Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylbenzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.4±40.0 °C at 760 mmHg |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.478 |
| Flash Point | 207.2±21.9 °C |
| Exact Mass | 316.240234 |
| PSA | 40.46000 |
| LogP | 7.47 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | QXACEHWTBCFNSA-SFQUDFHCSA-N |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1 |
| Storage condition | -20°C |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| Hazard Codes | Xn |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| HS Code | 2907299090 |
|
~29%
Cannabigerol CAS#:25654-31-3 |
| Literature: Baek, Seung-Hwa; Srebnik, Morris; Mechoulam, Raphael Tetrahedron Letters, 1985 , vol. 26, # 8 p. 1083 - 1086 |
|
~%
Cannabigerol CAS#:25654-31-3 |
| Literature: Tetrahedron, , vol. 21, # 5 p. 1223 - 1229 |
|
~%
Cannabigerol CAS#:25654-31-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 16, # 17 p. 8117 - 8126 |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 1,3-Benzenediol, 2-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-5-pentyl- |
| 1,3-Benzenediol, 2-(3,7-dimethyl-2,6-octadienyl)-5-pentyl- |
| Resorcinol, 2-(3,7-dimethyl-2,6-octadienyl)-5-pentyl- |
| 2-[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]-5-pentyl-1,3-benzenediol |
| Cannabigerol |