Benzenesulfonamide,3,4-dichloro-N-[(propylamino)carbonyl]- structure
|
Common Name | Benzenesulfonamide,3,4-dichloro-N-[(propylamino)carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 25672-38-2 | Molecular Weight | 311.18500 | |
| Density | 1.418g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12Cl2N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | anguidine, 3 keto |
|---|
| Density | 1.418g/cm3 |
|---|---|
| Molecular Formula | C10H12Cl2N2O3S |
| Molecular Weight | 311.18500 |
| Exact Mass | 309.99500 |
| PSA | 83.65000 |
| LogP | 4.25390 |
| Index of Refraction | 1.562 |
| InChIKey | MFSBMDDDBZVNEO-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonam... CAS#:25672-38-2 |
| Literature: Marshall; Sigal Journal of Organic Chemistry, 1958 , vol. 23, p. 927 |
|
~%
Benzenesulfonam... CAS#:25672-38-2 |
| Literature: Marshall; Sigal Journal of Organic Chemistry, 1958 , vol. 23, p. 927 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |