Spiroisobenzofuran-1(3H),9-9Hxanthen-3-one, 2,4,5-tribromo-3,6-dihydroxy structure
|
Common Name | Spiroisobenzofuran-1(3H),9-9Hxanthen-3-one, 2,4,5-tribromo-3,6-dihydroxy | ||
|---|---|---|---|---|
| CAS Number | 25709-83-5 | Molecular Weight | 568.99400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H9Br3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2',4',5'-tribromo-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H9Br3O5 |
|---|---|
| Molecular Weight | 568.99400 |
| Exact Mass | 565.80000 |
| PSA | 75.99000 |
| LogP | 5.95330 |
| InChIKey | YKZJCSJCUCCADE-UHFFFAOYSA-N |
| SMILES | O=C1OC2(c3ccccc31)c1ccc(O)c(Br)c1Oc1c2cc(Br)c(O)c1Br |
| HS Code | 2932999099 |
|---|
|
~%
Spiroisobenzofu... CAS#:25709-83-5 |
| Literature: Graichen; Molitor Journal of the Association of Official Agricultural Chemists, 1959 , vol. 42, p. 149,159 |
|
~%
Spiroisobenzofu... CAS#:25709-83-5 |
| Literature: Graichen; Molitor Journal of the Association of Official Agricultural Chemists, 1959 , vol. 42, p. 149,159 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2',4',5'-Tribrom-3',6'-dihydroxy-spiro[phthalan-1,9'-xanthen]-3-on |
| Spiro(isobenzofuran-1(3h),9'-(9h)xanthen)-3-one,2',4',5'-tribromo-3',6'-dihydroxy |
| UNII-J86L7YG48F |
| 2,4,5-Tribromfluorescein |
| Fluorescein,2',4',5'-tribromo |
| 2,4,5-Tribromofluorescein |
| 2',4',5'-tribromo-3',6'-dihydroxy-spiro[phthalan-1,9'-xanthen]-3-one |