isopropoxyacetic anhydride structure
|
Common Name | isopropoxyacetic anhydride | ||
|---|---|---|---|---|
| CAS Number | 25769-60-2 | Molecular Weight | 218.24700 | |
| Density | 1.05g/cm3 | Boiling Point | 249ºC at 760mmHg | |
| Molecular Formula | C10H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.6ºC | |
| Name | (2-propan-2-yloxyacetyl) 2-propan-2-yloxyacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 249ºC at 760mmHg |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.24700 |
| Flash Point | 100.6ºC |
| Exact Mass | 218.11500 |
| PSA | 61.83000 |
| LogP | 0.90620 |
| Vapour Pressure | 0.0234mmHg at 25°C |
| Index of Refraction | 1.429 |
| InChIKey | TYZQUYUIVHHLBA-UHFFFAOYSA-N |
| SMILES | CC(C)OCC(=O)OC(=O)COC(C)C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Isopropoxyacetic anhydride |
| Isopropyloxyessigsaeure-anhydrid |