Perfluorooctanoic anhydride structure
|
Common Name | Perfluorooctanoic anhydride | ||
|---|---|---|---|---|
| CAS Number | 33496-48-9 | Molecular Weight | 810.12100 | |
| Density | 1.745g/cm3 | Boiling Point | 188ºC at 760mmHg | |
| Molecular Formula | C16F30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 62.1ºC | |
| Name | Perfluorooctanoic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.745g/cm3 |
|---|---|
| Boiling Point | 188ºC at 760mmHg |
| Molecular Formula | C16F30O3 |
| Molecular Weight | 810.12100 |
| Flash Point | 62.1ºC |
| Exact Mass | 809.93700 |
| PSA | 43.37000 |
| LogP | 8.80440 |
| Index of Refraction | 1.288 |
| InChIKey | NBEDTLDKOMPAQK-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3265 |
| HS Code | 2915900090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |