phenylmalonic acid monobenzyl ester structure
|
Common Name | phenylmalonic acid monobenzyl ester | ||
|---|---|---|---|---|
| CAS Number | 25774-02-1 | Molecular Weight | 270.28000 | |
| Density | 1.258g/cm3 | Boiling Point | 432.1ºC at 760mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | 64-66°C | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | phenylmalonic acid monobenzyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 432.1ºC at 760mmHg |
| Melting Point | 64-66°C |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 160.2ºC |
| Exact Mass | 270.08900 |
| PSA | 63.60000 |
| LogP | 2.59820 |
| Vapour Pressure | 3.12E-08mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | QSBAHMROFICXDC-UHFFFAOYSA-N |
| SMILES | O=C(O)C(C(=O)OCc1ccccc1)c1ccccc1 |
|
~%
phenylmalonic a... CAS#:25774-02-1 |
| Literature: Journal of the Chemical Society, Chemical Communications, , # 10 p. 1197 - 1198 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| phenyl malonic acid monobenzyl ester |
| benzyl hydrogen phenylmalonate |
| MONOBENZYL PHENYLMALONATE |
| 2-Phenylpropanedioic acid hydrogen 1-phenylmethyl ester |
| monobenzyl 2-phenylmalonate |
| EINECS 247-257-7 |
| 2-phenylpropanedioic acid monobenzyl ester |
| Phenylmalonic Acid Monobenzyl Ester |
| MFCD00051723 |
| benzyl hydrogen 2-phenylmalonate |