N-Monoacetylcystine
Modify Date: 2025-01-05 20:02:09
N-Monoacetylcystine structure
|
Common Name | N-Monoacetylcystine | ||
|---|---|---|---|---|
| CAS Number | 25779-79-7 | Molecular Weight | 282.33700 | |
| Density | 1.5g/cm3 | Boiling Point | 596.7ºC at 760mmHg | |
| Molecular Formula | C8H14N2O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.7ºC | |
Use of N-MonoacetylcystineN-Monoacetylcystine is an antidote for paracetamol poisoning. It is also an antioxidant, used in the treatment of influenza A virus pandemic. N-Acetyl-L-cystine promotes fertilization by reducing disulfide bonds in zona pellucida of mouse. |
| Name | 3-[(2-acetamido-2-carboxyethyl)disulfanyl]-2-aminopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 596.7ºC at 760mmHg |
| Molecular Formula | C8H14N2O5S2 |
| Molecular Weight | 282.33700 |
| Flash Point | 314.7ºC |
| Exact Mass | 282.03400 |
| PSA | 183.81000 |
| LogP | 0.90960 |
| Vapour Pressure | 8.88E-16mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | ZLCOWUKVVFVVKA-WDSKDSINSA-N |
| SMILES | CC(=O)NC(CSSCC(N)C(=O)O)C(=O)O |
| C8H14N2O5S2 |
| L-Cystine,N-acetyl |
| N-Monoacetylcystine |
| 3-[(2-acetamido-3-hydroxy-3-oxopropyl)disulfanyl]-2-aminopropanoic acid |
| N-Acetylcystine |