tert-butyl 4-hydroxybenzoate structure
|
Common Name | tert-butyl 4-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 25804-49-3 | Molecular Weight | 194.227 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 295.6±13.0 °C at 760 mmHg | |
| Molecular Formula | C11H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.5±12.6 °C | |
| Name | tert-butyl 4-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 295.6±13.0 °C at 760 mmHg |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.227 |
| Flash Point | 121.5±12.6 °C |
| Exact Mass | 194.094299 |
| PSA | 46.53000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | WHWMOMRHHQLBQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccc(O)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918290000 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| EINECS 247-272-9 |
| tert-butyl 4-hydroxybenzoate |
| 1,1-dimethylethyl 4-hydroxybenzoate |
| tert-butyl 4-hydroxy-benzoate |
| Benzoic acid, 4-hydroxy-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 4-hydroxybenzoate |
| 4-hydroxy-benzoic acid tert-butyl ester |
| 4-hydroxybenzoic acid 1,1-dimethylethyl ester |