diethyl (4-amino-3-chlorophenyl)methylmalonate structure
|
Common Name | diethyl (4-amino-3-chlorophenyl)methylmalonate | ||
|---|---|---|---|---|
| CAS Number | 25814-36-2 | Molecular Weight | 299.75000 | |
| Density | 1.234g/cm3 | Boiling Point | 394.5ºC at 760mmHg | |
| Molecular Formula | C14H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | diethyl 2-[(4-amino-3-chlorophenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 394.5ºC at 760mmHg |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75000 |
| Flash Point | 192.4ºC |
| Exact Mass | 299.09200 |
| PSA | 78.62000 |
| LogP | 2.78830 |
| Vapour Pressure | 1.98E-06mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | AGTISSMCQXEKEI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(N)c(Cl)c1)C(=O)OCC |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| diethyl(4-amino-3-chlorobenzyl)propanedioate |
| Diethyl (4-amino-3-chlorophenyl)methylmalonate |
| EINECS 247-281-8 |