diethyl (3-chloro-4-nitrophenyl)methylmalonate structure
|
Common Name | diethyl (3-chloro-4-nitrophenyl)methylmalonate | ||
|---|---|---|---|---|
| CAS Number | 26039-74-7 | Molecular Weight | 329.73300 | |
| Density | 1.306g/cm3 | Boiling Point | 430.5ºC at 760mmHg | |
| Molecular Formula | C14H16ClNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | diethyl 2-[(3-chloro-4-nitrophenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 430.5ºC at 760mmHg |
| Molecular Formula | C14H16ClNO6 |
| Molecular Weight | 329.73300 |
| Flash Point | 214.2ºC |
| Exact Mass | 329.06700 |
| PSA | 98.42000 |
| LogP | 3.05630 |
| Vapour Pressure | 1.29E-07mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | GWCWXTTXHCXPCW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc([N+](=O)[O-])c(Cl)c1)C(=O)OCC |
| Storage condition | 2-8℃ |
| HS Code | 2917399090 |
|---|
|
~%
diethyl (3-chlo... CAS#:26039-74-7 |
| Literature: Peretto, Ilaria; Radaelli, Stefano; Parini, Carlo; Zandi, Michele; Raveglia, Luca F.; Dondio, Giulio; Fontanella, Laura; Misiano, Paola; Bigogno, Chiara; Rizzi, Andrea; Riccardi, Benedetta; Biscaioli, Marcello; Marchetti, Silvia; Puccini, Paola; Catinella, Silvia; Rondelli, Ivano; Cenacchi, Valentina; Bolzoni, Pier Tonino; Caruso, Paola; Villetti, Gino; Facchinetti, Fabrizio; Del Giudice, Elda; Moretto, Nadia; Imbimbo, Bruno P. Journal of Medicinal Chemistry, 2005 , vol. 48, # 18 p. 5705 - 5720 |
|
~%
diethyl (3-chlo... CAS#:26039-74-7 |
| Literature: Naito; Goto; Akahoshi; Ono; Yoshitomi; Okano; Sugiyama; Abe; Hanada; Hirata; Watanabe; Fukaya; Yokoyama; Fujita Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 9 p. 2323 - 2332 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| diethyl (3-chloro-4-nitrophenyl)methylmalonate |
| Diethyl 2-(3-chloro-4-nitrophenyl)-2-methylmalonate |
| EINECS 247-424-4 |
| diethyl(3-chloro-4-nitrobenzyl)propanedioate |