Urea,N,N-dibutyl-N'-phenyl- structure
|
Common Name | Urea,N,N-dibutyl-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 2589-21-1 | Molecular Weight | 248.36400 | |
| Density | 1.012g/cm3 | Boiling Point | 405ºC at 760 mmHg | |
| Molecular Formula | C15H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | 1,1-Dibutyl-3-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 405ºC at 760 mmHg |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.36400 |
| Flash Point | 198.7ºC |
| Exact Mass | 248.18900 |
| PSA | 32.34000 |
| LogP | 4.19370 |
| Vapour Pressure | 9.07E-07mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | VLAGNIMOLLTGGE-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C(=O)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Urea,1,1-dibutyl-3-phenyl |
| Urea,N,N-dibutyl-N'-phenyl |
| (dibutylamino)-N-benzamide |
| N,N-di(n-butyl)-N'-phenylurea |
| N-phenyl-N',N'-dibutylurea |
| 1,1'-dibutyl-3-phenylurea |
| N,N-dibutyl-N'-phenylurea |
| 3,3-dibutyl-1-phenylurea |