4'-Benzyloxy-6'-hydroxy-2',3'-dimethoxyacetophenone structure
|
Common Name | 4'-Benzyloxy-6'-hydroxy-2',3'-dimethoxyacetophenone | ||
|---|---|---|---|---|
| CAS Number | 25892-95-9 | Molecular Weight | 302.32200 | |
| Density | 1.199±0.06 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(6-hydroxy-2,3-dimethoxy-4-phenylmethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.199±0.06 g/cm3 |
|---|---|
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.32200 |
| Exact Mass | 302.11500 |
| PSA | 64.99000 |
| LogP | 3.19100 |
| Index of Refraction | 1.57 |
| InChIKey | DHPZTYWSWZIJME-UHFFFAOYSA-N |
| SMILES | COc1c(OCc2ccccc2)cc(O)c(C(C)=O)c1OC |
| Water Solubility | Practically insoluble (0.057 g/L) (25 ºC) |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Benzyloxy-2-hydroxy-5,6-dimethoxyacetophenone |
| 1-(4-(BENZYLOXY)-6-HYDROXY-2,3-DIMETHOXYPHENYL)ETHANONE |
| 4-Benzyloxy-2-hydroxy-5,6-dimethoxyacetophenon |
| I01-8809 |
| 2-hydroxy-4-benzyloxy-5,6-dimethoxyacetophenone |
| QC-8452 |
| 4-benzyloxy-2,3-dimethoxy-6-hydroxyacetophenone |
| 4'-Benzyloxy-6'-hydroxy-2',3'-dimethoxyacetophenone |