21-fluoro-16-ethyl-19-norprogesterone structure
|
Common Name | 21-fluoro-16-ethyl-19-norprogesterone | ||
|---|---|---|---|---|
| CAS Number | 25908-76-3 | Molecular Weight | 346.47900 | |
| Density | 1.11g/cm3 | Boiling Point | 478.7ºC at 760 mmHg | |
| Molecular Formula | C22H31FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.7ºC | |
| Name | (8R,9S,10R,13S,14S,17S)-16-ethyl-17-(2-fluoroacetyl)-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 478.7ºC at 760 mmHg |
| Molecular Formula | C22H31FO2 |
| Molecular Weight | 346.47900 |
| Flash Point | 179.7ºC |
| Exact Mass | 346.23100 |
| PSA | 34.14000 |
| LogP | 4.91910 |
| Vapour Pressure | 2.52E-09mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | XVMNSRXVKUOGOY-PPBDDGJCSA-N |
| SMILES | CCC1CC2C3CCC4=CC(=O)CCC4C3CCC2(C)C1C(=O)CF |
|
~%
21-fluoro-16-et... CAS#:25908-76-3 |
| Literature: Pomper; Katzenellenbogen; Welch; Brodack; Mathias Journal of medicinal chemistry, 1988 , vol. 31, # 7 p. 1360 - 1363 |
|
~%
21-fluoro-16-et... CAS#:25908-76-3 |
| Literature: Pomper; Katzenellenbogen; Welch; Brodack; Mathias Journal of medicinal chemistry, 1988 , vol. 31, # 7 p. 1360 - 1363 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 21-Fluoro-16-ethyl-19-norprogesterone |
| FENP |