pinacryptol yellow structure
|
Common Name | pinacryptol yellow | ||
|---|---|---|---|---|
| CAS Number | 25910-85-4 | Molecular Weight | 446.474 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O7S | Melting Point | 260-262 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 6-ethoxy-1-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]quinolin-1-ium,methyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 260-262 °C(lit.) |
|---|---|
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.474 |
| Exact Mass | 446.114777 |
| PSA | 133.74000 |
| LogP | 4.83860 |
| InChIKey | ZXQHSPWBYMLHLB-BXTVWIJMSA-M |
| SMILES | CCOc1ccc2c(ccc(C=Cc3cccc([N+](=O)[O-])c3)[n+]2C)c1.COS(=O)(=O)[O-] |
| Storage condition | -70°C |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933499090 |
|
~%
pinacryptol yellow CAS#:25910-85-4 |
| Literature: Journal of the American Chemical Society, , vol. 77, p. 1687,1690 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Entamoeba mitosomes play an important role in encystation by association with cholesteryl sulfate synthesis.
Proc. Natl. Acad. Sci. U. S. A. 112 , E2884-90, (2015) Hydrogenosomes and mitosomes are mitochondrion-related organelles (MROs) that have highly reduced and divergent functions in anaerobic/microaerophilic eukaryotes. Entamoeba histolytica, a microaerophi... |
| 6-Ethoxy-1-methyl-2-(3-nitrostyryl)-quinolinium Methyl Sulfate |
| Pinakryptol Yellow |
| 6-Ethoxy-1-methyl-2-[(E)-2-(3-nitrophenyl)vinyl]quinolinium methyl sulfate |
| MFCD00011967 |
| EINECS 247-336-6 |
| pinacryptol yellow |