tert-Butyl 4-(fluoromethyl)piperidine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(fluoromethyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 259143-03-8 | Molecular Weight | 217.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-Butyl 4-(fluoromethyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H20FNO2 |
|---|---|
| Molecular Weight | 217.28000 |
| Exact Mass | 217.14800 |
| PSA | 29.54000 |
| LogP | 2.54090 |
| InChIKey | JPONZPZEVAZHJW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CF)CC1 |
|
~51%
tert-Butyl 4-(f... CAS#:259143-03-8 |
| Literature: DAIICHI PHARMACEUTICAL CO., LTD. Patent: EP1785418 A1, 2007 ; Location in patent: Page/Page column 45 ; |
|
~80%
tert-Butyl 4-(f... CAS#:259143-03-8 |
| Literature: Gilissen; Bormans; De Groot; Verbruggen Journal of Labelled Compounds and Radiopharmaceuticals, 1999 , vol. 42, # 13 p. 1289 - 1300 |
|
~%
tert-Butyl 4-(f... CAS#:259143-03-8 |
| Literature: Gilissen; Bormans; De Groot; Verbruggen Journal of Labelled Compounds and Radiopharmaceuticals, 1999 , vol. 42, # 13 p. 1289 - 1300 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Boronic acid,[4-(fluoromethyl)phenyl]-(9CI) |
| {4-(fluoromethyl)benzene}boronic acid |
| 4-fluoromethylphenylboronic acid |
| Boronic acid,[4-(fluoromethyl)phenyl] |
| 4-fluoromethylpiperidine-1-carboxylic acid tert-butyl ester |
| N-BOC-4-fluoromethylpiperidine |