Methyl 4,5,8-trimethoxy-2-naphthoate structure
|
Common Name | Methyl 4,5,8-trimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 25932-92-7 | Molecular Weight | 276.28500 | |
| Density | 1.183g/cm3 | Boiling Point | 427.7ºC at 760 mmHg | |
| Molecular Formula | C15H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.5ºC | |
| Name | Methyl 4,5,8-trimethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 427.7ºC at 760 mmHg |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.28500 |
| Flash Point | 190.5ºC |
| Exact Mass | 276.10000 |
| PSA | 53.99000 |
| LogP | 2.65220 |
| Vapour Pressure | 1.61E-07mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | XDNKHSNZDFDESL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(OC)ccc(OC)c2c1 |
|
~%
Methyl 4,5,8-tr... CAS#:25932-92-7 |
| Literature: Baker, Robert W.; Liu, Song; Sargent, Melvyn V.; Skelton, Brian W.; White, Allan H. Australian Journal of Chemistry, 1997 , vol. 50, # 8 p. 831 - 840 |
|
~%
Methyl 4,5,8-tr... CAS#:25932-92-7 |
|
Literature: Harper,S.H. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 4,5,8-Trihydroxy-1,2,3,4-tetrahydro-isochinolin-hydrochlorid |
| 4,5,8-Trimethoxy-2-naphthoesaeuremethylester |
| 4,5,8-Trimethoxy-2-naphthoesaeure |