4,5,8-Trimethoxy-2-naphthoic acid structure
|
Common Name | 4,5,8-Trimethoxy-2-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 25932-93-8 | Molecular Weight | 262.25800 | |
| Density | 1.26g/cm3 | Boiling Point | 447.4ºC at 760 mmHg | |
| Molecular Formula | C14H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | 4,5,8-Trimethoxy-2-naphthoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 447.4ºC at 760 mmHg |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.25800 |
| Flash Point | 170.5ºC |
| Exact Mass | 262.08400 |
| PSA | 64.99000 |
| LogP | 2.56380 |
| Vapour Pressure | 8.65E-09mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | IATNBHCVQPLOTG-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c2c(OC)cc(C(=O)O)cc12 |
|
~%
4,5,8-Trimethox... CAS#:25932-93-8 |
|
Literature: Harper,S.H. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
|
~%
4,5,8-Trimethox... CAS#:25932-93-8 |
|
Literature: Harper,S.H. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,5,8-Trihydroxy-1,2,3,4-tetrahydro-isochinolin-hydrochlorid |
| 4,5,8-Trimethoxy-2-naphthoesaeure |