4-Amino-4'-hydroxydiphenylsulfone structure
|
Common Name | 4-Amino-4'-hydroxydiphenylsulfone | ||
|---|---|---|---|---|
| CAS Number | 25963-47-7 | Molecular Weight | 249.28600 | |
| Density | 1.396g/cm3 | Boiling Point | 508.5ºC at 760mmHg | |
| Molecular Formula | C12H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.3ºC | |
| Name | 4-(4-aminophenyl)sulfonylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 508.5ºC at 760mmHg |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.28600 |
| Flash Point | 261.3ºC |
| Exact Mass | 249.04600 |
| PSA | 88.77000 |
| LogP | 3.46920 |
| Vapour Pressure | 5.84E-11mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | PSHPCZGANRRQDN-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(O)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Sulfanilylphenol |
| 4-Sulfanilyl-phenol |
| 4-[(4-AMINOPHENYL)SULFONYL]PHENOL |
| 4-Amino-4'-hydroxydiphenylsulfone |
| 4-(4-Amino-phenylsulfon)-phenol |
| (4-Amino-phenyl)-(4-hydroxy-phenyl)-sulfon |