ethyl 1-(2-formylphenyl)piperidine-4-carboxylate structure
|
Common Name | ethyl 1-(2-formylphenyl)piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 259683-56-2 | Molecular Weight | 261.31600 | |
| Density | 1.148g/cm3 | Boiling Point | 393.6ºC at 760mmHg | |
| Molecular Formula | C15H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.9ºC | |
| Name | ethyl 1-(2-formylphenyl)piperidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 393.6ºC at 760mmHg |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.31600 |
| Flash Point | 191.9ºC |
| Exact Mass | 261.13600 |
| PSA | 46.61000 |
| LogP | 2.34360 |
| Vapour Pressure | 2.1E-06mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | XYGFKYRHCMLPNU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(c2ccccc2C=O)CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00662563 |