(1R, 2R, 5S)-NEOMENTHYL AZIDE structure
|
Common Name | (1R, 2R, 5S)-NEOMENTHYL AZIDE | ||
|---|---|---|---|---|
| CAS Number | 259826-43-2 | Molecular Weight | 181.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1R,2R,4S)-2-azido-4-methyl-1-propan-2-ylcyclohexane |
|---|
| Molecular Formula | C10H19N3 |
|---|---|
| Molecular Weight | 181.27800 |
| Exact Mass | 181.15800 |
| PSA | 49.75000 |
| LogP | 3.21026 |
| InChIKey | JWXCHQXAHQOURC-IVZWLZJFSA-N |
| SMILES | CC1CCC(C(C)C)C(N=[N+]=[N-])C1 |
|
~88%
(1R, 2R, 5S)-NE... CAS#:259826-43-2 |
| Literature: Ito; Koyakumaru; Ohta; Takaya Synthesis, 1995 , # 4 p. 376 - 378 |
|
~66%
(1R, 2R, 5S)-NE... CAS#:259826-43-2 |
| Literature: Papeo, Gianluca; Posteri, Helena; Vianello, Paola; Varasi, Mario Synthesis, 2004 , # 17 p. 2886 - 2892 |
|
~73%
(1R, 2R, 5S)-NE... CAS#:259826-43-2 |
| Literature: Viaud, Marie Claude; Rollin, Patrick Synthesis, 1990 , # 2 p. 130 - 132 |
|
~%
(1R, 2R, 5S)-NE... CAS#:259826-43-2 |
| Literature: Barton,D.H.R.; Morgan,L.R. Journal of the Chemical Society, 1962 , p. 622 - 631 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |