(E)-1-(Styrylsulfonyl)piperidine-4-carboxylic acid structure
|
Common Name | (E)-1-(Styrylsulfonyl)piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 260441-69-8 | Molecular Weight | 295.35400 | |
| Density | 1.35g/cm3 | Boiling Point | 503.5ºC at 760 mmHg | |
| Molecular Formula | C14H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.3ºC | |
| Name | 1-[[(e)-2-phenylvinyl]sulfonyl]piperidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 503.5ºC at 760 mmHg |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.35400 |
| Flash Point | 258.3ºC |
| Exact Mass | 295.08800 |
| PSA | 83.06000 |
| LogP | 2.80240 |
| Vapour Pressure | 5.84E-11mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | LAFAILDKFOBJFF-DHZHZOJOSA-N |
| SMILES | O=C(O)C1CCN(S(=O)(=O)C=Cc2ccccc2)CC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD02658824 |