Boc-L-Asp(Bzl)-ONp structure
|
Common Name | Boc-L-Asp(Bzl)-ONp | ||
|---|---|---|---|---|
| CAS Number | 26048-69-1 | Molecular Weight | 444.435 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 609.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H24N2O8 | Melting Point | 106℃ | |
| MSDS | N/A | Flash Point | 322.6±31.5 °C | |
| Name | 4-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.9±55.0 °C at 760 mmHg |
| Melting Point | 106℃ |
| Molecular Formula | C22H24N2O8 |
| Molecular Weight | 444.435 |
| Flash Point | 322.6±31.5 °C |
| Exact Mass | 444.153259 |
| PSA | 136.75000 |
| LogP | 5.21 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | GKRBDGLUYWLXAX-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OCc1ccccc1)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~66%
Boc-L-Asp(Bzl)-ONp CAS#:26048-69-1 |
| Literature: Masar, Bohumil; Schmidt, Pavel; Pivcova, Hana; Cefelin, Pavel Collection of Czechoslovak Chemical Communications, 1987 , vol. 52, # 8 p. 1922 - 1927 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Benzyl 1-(4-nitrophenyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate |
| L-Aspartic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 1-(4-nitrophenyl) 4-(phenylmethyl) ester |
| Boc-Asp(OBzl)-ONp |