Boc-L-2-Bromophenylalanine structure
|
Common Name | Boc-L-2-Bromophenylalanine | ||
|---|---|---|---|---|
| CAS Number | 261165-02-0 | Molecular Weight | 344.201 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 471.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H18BrNO4 | Melting Point | 142.1ºC | |
| MSDS | USA | Flash Point | 238.8±27.3 °C | |
| Name | (2S)-3-(2-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 471.3±40.0 °C at 760 mmHg |
| Melting Point | 142.1ºC |
| Molecular Formula | C14H18BrNO4 |
| Molecular Weight | 344.201 |
| Flash Point | 238.8±27.3 °C |
| Exact Mass | 343.041901 |
| PSA | 75.63000 |
| LogP | 3.73 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | XDJSTMCSOXSTGZ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1Br)C(=O)O |
| Storage condition | Store at 0°C |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2S)-3-(2-Bromophenyl)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| Boc-D-phe(2-Br)-OH |
| (S)-N-BOC-2-Bromophenylalanine |
| BOC-L-2-BROMOPHE |
| L-Phenylalanine, 2-bromo-N-[(1,1-dimethylethoxy)carbonyl]- |
| Boc-2-bromo-L-phenylalanine |
| Boc-Phe(2-Br)-OH |
| (2S)-3-(2-bromophenyl)-2-[(tert-butoxycarbonyl)amino]propanoic acid |
| Fmoc-Phe(2-Br)-OH |
| MFCD01317709 |
| 2-Bromo-N-(tert-butoxycarbonyl)-L-phenylalanine |
| (2S)-2-[(tert-butoxy)carbonylamino]-3-(2-bromophenyl)propanoic acid |
| Boc-L-2-Bromophenylalanine |
| 2-Bromo-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |