(1R,3S)-N-Boc-1-Aminocyclopentane-3-carboxylic acid structure
|
Common Name | (1R,3S)-N-Boc-1-Aminocyclopentane-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 261165-05-3 | Molecular Weight | 229.273 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 382.5±31.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO4 | Melting Point | 35-49ºC | |
| MSDS | Chinese USA | Flash Point | 185.1±24.8 °C | |
| Name | (1S,3R)-Boc-3-aminocyclopentane-1 carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.5±31.0 °C at 760 mmHg |
| Melting Point | 35-49ºC |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.273 |
| Flash Point | 185.1±24.8 °C |
| Exact Mass | 229.131409 |
| PSA | 75.63000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | RNJQBGXOSAQQDG-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(C(=O)O)C1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~10%
(1R,3S)-N-Boc-1... CAS#:261165-05-3 |
| Literature: MERCK and CO., INC. Patent: WO2005/110409 A2, 2005 ; Location in patent: Page/Page column 30 ; WO 2005/110409 A2 |
|
~%
(1R,3S)-N-Boc-1... CAS#:261165-05-3 |
| Literature: TAISHO PHARMACEUTICAL CO., LTD.; ARENA PHARMACEUTICALS, INC. Patent: WO2006/35967 A1, 2006 ; Location in patent: Page/Page column 100-101 ; WO 2006/035967 A1 |
|
~%
(1R,3S)-N-Boc-1... CAS#:261165-05-3 |
| Literature: GLENMARK PHARMACEUTICALS LTD. Patent: WO2006/11035 A1, 2006 ; Location in patent: Page/Page column 26-27 ; WO 2006/011035 A1 |
|
~%
(1R,3S)-N-Boc-1... CAS#:261165-05-3 |
| Literature: Madar, David J.; Djuric, Stevan W.; Michmerhuizen, Melissa J.; Kopecka, Hana A.; Li, Xiaofeng; Longenecker, Kenton L.; Pei, Zhonghua; Pireh, Daisy; Sham, Hing L.; Stewart, Kent D.; Szczepankiewicz, Bruce G.; Wiedeman, Paul E.; Yong, Hong Patent: US2005/215784 A1, 2005 ; US 20050215784 A1 |
|
~%
(1R,3S)-N-Boc-1... CAS#:261165-05-3 |
| Literature: Brea, Roberto J.; Amorin, Manuel; Castedo, Luis; Granja, Juan R. Angewandte Chemie - International Edition, 2005 , vol. 44, # 35 p. 5710 - 5713 |
|
~%
(1R,3S)-N-Boc-1... CAS#:261165-05-3 |
| Literature: Brea, Roberto J.; Amorin, Manuel; Castedo, Luis; Granja, Juan R. Angewandte Chemie - International Edition, 2005 , vol. 44, # 35 p. 5710 - 5713 |
|
~%
(1R,3S)-N-Boc-1... CAS#:261165-05-3 |
| Literature: Zeitlmann, Lutz; Niestroj, Andre; Heiser, Ulrich Patent: US2011/224225 A1, 2011 ; US 20110224225 A1 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01320857 |
| Cyclopentanecarboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, (1S,3R)- |
| (1R,3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclopentanecarboxylic acid |
| (1S,3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclopentanecarboxylic acid |
| (1S,3R)-3-(Boc-amino)cyclopentanecarboxylic Acid |
| Cyclopentanecarboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, (1R,3S)- |
| (+)-(1S,3R)-N-Boc-b-homocycloleucine |
| (+)-(1S,3R)-N-Boc-3-aMinocyclopentanecarboxylic acidacid |
| (1S,3R)-3-(tert-butoxycarbonylamino)cyclopentanecarboxylic acid |
| (1S,3R)-cyclopentanecarboxylic acid 3-[[(1,1-dimethylethoxy)carbonyl]amino] |
| (1S,3R)-3-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid |
| (1R,3S)-N-boc-1-Aminocyclopentane-3-carboxylicacid(e.e.) |
| (+)-(1R,3S)-N-BOC-1-AMINOCYCLOPENTANE-3-CARBOXYLIC ACID |
| (1S,3R)-(+)-3-(Boc-amino)cyclopentanecarboxylic acid |
| (1S,3R)-3-amino-N-tert-butyloxycarbonylcyclopentanecarboxylic acid |
| (1S,3R)-N-Boc-3-aminocyclopentanecarboxylic acid |