3H,3H-PERFLUOROOCTANE-2,4-DIONE structure
|
Common Name | 3H,3H-PERFLUOROOCTANE-2,4-DIONE | ||
|---|---|---|---|---|
| CAS Number | 261503-40-6 | Molecular Weight | 358.08100 | |
| Density | 1.624g/cm3 | Boiling Point | 156.1ºC at 760mmHg | |
| Molecular Formula | C8H2F12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 55ºC | |
| Name | 1,1,1,5,5,6,6,7,7,8,8,8-dodecafluorooctane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.624g/cm3 |
|---|---|
| Boiling Point | 156.1ºC at 760mmHg |
| Molecular Formula | C8H2F12O2 |
| Molecular Weight | 358.08100 |
| Flash Point | 55ºC |
| Exact Mass | 357.98600 |
| PSA | 34.14000 |
| LogP | 3.54520 |
| Vapour Pressure | 2.94mmHg at 25°C |
| Index of Refraction | 1.297 |
| InChIKey | WNIYZRDLOGYCIO-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3H,3H-Perfluorooctane-2,4-dione |