1-Naphthaleneethanol acetate structure
|
Common Name | 1-Naphthaleneethanol acetate | ||
|---|---|---|---|---|
| CAS Number | 26157-05-1 | Molecular Weight | 232.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,2-naphthalen-1-ylethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O3 |
|---|---|
| Molecular Weight | 232.27500 |
| Exact Mass | 232.11000 |
| PSA | 57.53000 |
| LogP | 2.46550 |
| InChIKey | LMWSKTNOETTYDF-UHFFFAOYSA-N |
| SMILES | CC(=O)O.OCCc1cccc2ccccc12 |
| HS Code | 2915390090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2-Acetoxy-1-(naphthyl-(1))-aethan |
| 1-(2-Acetoxy-aethyl)-naphthalin |
| acetic acid-(2-[1]naphthyl-ethyl ester) |
| 1-(2-acetoxyethyl)naphthalene |
| 2-(naphthalen-1-yl)ethyl acetate |
| Essigsaeure-(2-[1]naphthyl-aethylester) |
| 2-(1-naphthyl)ethyl acetate |