3-chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde structure
|
Common Name | 3-chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 261763-02-4 | Molecular Weight | 226.55500 | |
| Density | 1.54 g/mL at 25 °C(lit.) | Boiling Point | 196 °C(lit.) | |
| Molecular Formula | C8H3ClF4O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 205 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-chloro-2-fluoro-5-(trifluoromethyl)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 196 °C(lit.) |
| Molecular Formula | C8H3ClF4O |
| Molecular Weight | 226.55500 |
| Flash Point | 205 °F |
| Exact Mass | 225.98100 |
| PSA | 17.07000 |
| LogP | 3.31040 |
| Vapour Pressure | 0.401mmHg at 25°C |
| Index of Refraction | n20/D 1.476(lit.) |
| InChIKey | MSZTVIFIFJCNRQ-UHFFFAOYSA-N |
| SMILES | O=Cc1cc(C(F)(F)F)cc(Cl)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
QSAR modeling of aquatic toxicity of aromatic aldehydes using artificial neural network (ANN) and multiple linear regression (MLR). Louis B and Agrawal VK.
J. Ind. Chem. Soc. 88(1) , 99, (2011)
|
| MFCD01631510 |