2-Thiazolamine,5-[2-(3-methoxyphenyl)diazenyl]-4-phenyl- structure
|
Common Name | 2-Thiazolamine,5-[2-(3-methoxyphenyl)diazenyl]-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 26179-13-5 | Molecular Weight | 310.37400 | |
| Density | 1.31g/cm3 | Boiling Point | 444.4ºC at 760mmHg | |
| Molecular Formula | C16H14N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.6ºC | |
| Name | N-[(E)-(2-imino-4-phenyl-1,3-thiazol-5-ylidene)amino]-3-methoxyaniline |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 444.4ºC at 760mmHg |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.37400 |
| Flash Point | 222.6ºC |
| Exact Mass | 310.08900 |
| PSA | 101.10000 |
| LogP | 5.39750 |
| Vapour Pressure | 4.28E-08mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | ICWLRERHAJYQMT-UHFFFAOYSA-N |
| SMILES | COc1cccc(N=Nc2sc(N)nc2-c2ccccc2)c1 |
|
~%
2-Thiazolamine,... CAS#:26179-13-5 |
| Literature: Garg; Sharma Journal of pharmaceutical sciences, 1970 , vol. 59, # 3 p. 348 - 353 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |