2-Thiazolamine,5-[2-(2-chloro-4-nitrophenyl)diazenyl]-4-phenyl- structure
|
Common Name | 2-Thiazolamine,5-[2-(2-chloro-4-nitrophenyl)diazenyl]-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 26179-28-2 | Molecular Weight | 359.79000 | |
| Density | 1.57g/cm3 | Boiling Point | 495.3ºC at 760mmHg | |
| Molecular Formula | C15H10ClN5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.3ºC | |
| Name | 2-chloro-N-[(E)-(2-imino-4-phenyl-1,3-thiazol-5-ylidene)amino]-4-nitroaniline |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 495.3ºC at 760mmHg |
| Molecular Formula | C15H10ClN5O2S |
| Molecular Weight | 359.79000 |
| Flash Point | 253.3ºC |
| Exact Mass | 359.02400 |
| PSA | 137.69000 |
| LogP | 6.47370 |
| Vapour Pressure | 5.99E-10mmHg at 25°C |
| Index of Refraction | 1.75 |
| InChIKey | JZDBQJPUZNIJAL-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2)c(N=Nc2ccc([N+](=O)[O-])cc2Cl)s1 |
|
~%
2-Thiazolamine,... CAS#:26179-28-2 |
| Literature: Garg; Sharma Journal of pharmaceutical sciences, 1970 , vol. 59, # 3 p. 348 - 353 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |