CHEMBRDG-BB 6495124 structure
|
Common Name | CHEMBRDG-BB 6495124 | ||
|---|---|---|---|---|
| CAS Number | 26189-47-9 | Molecular Weight | 296.10600 | |
| Density | 1.456g/cm3 | Boiling Point | 462.9ºC at 760 mmHg | |
| Molecular Formula | C13H7Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.8ºC | |
| Name | (3,4-dichlorophenyl)(4-nitrophenyl)Methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 462.9ºC at 760 mmHg |
| Molecular Formula | C13H7Cl2NO3 |
| Molecular Weight | 296.10600 |
| Flash Point | 233.8ºC |
| Exact Mass | 294.98000 |
| PSA | 62.89000 |
| LogP | 4.65580 |
| Vapour Pressure | 9.49E-09mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | IFGAYPOJJFHTSW-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2914700090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,4-dichloro-4'-nitro-benzophenone |
| 3,4-Dichlor-4'-nitro-benzophenon |