isotaxiresinol structure
|
Common Name | isotaxiresinol | ||
|---|---|---|---|---|
| CAS Number | 26194-57-0 | Molecular Weight | 346.37 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 607.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.2±31.5 °C | |
Use of isotaxiresinolIsotaxiresinol is a lignan, which can be isolated from Taxus yunnanensis and has the function of plant metabolites[1]. |
| Name | Methyl 3-bromo-2-thiophenecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Isotaxiresinol is a lignan, which can be isolated from Taxus yunnanensis and has the function of plant metabolites[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 607.6±55.0 °C at 760 mmHg |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.37 |
| Flash Point | 321.2±31.5 °C |
| Exact Mass | 346.141632 |
| PSA | 110.38000 |
| LogP | 1.33 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | GQLVRVYXAHDDLB-PJFSTRORSA-N |
| SMILES | COc1cc2c(cc1O)C(c1ccc(O)c(O)c1)C(CO)C(CO)C2 |
| Hazard Codes | Xi |
|---|
| 7-MAC or 7-AMAC |
| 4-[(1S,2R,3R)-7-Hydroxy-2,3-bis(hydroxymethyl)-6-methoxy-1,2,3,4-tetrahydro-1-naphthalenyl]-1,2-benzenediol |
| 7-MAC |
| 2,3-Naphthalenedimethanol, 1-(3,4-dihydroxyphenyl)-1,2,3,4-tetrahydro-7-hydroxy-6-methoxy-, (1S,2R,3R)- |
| isotaxiresinol |