Benzene,1,1'-(chloroethenylidene)bis[4-bromo- (9CI) structure
|
Common Name | Benzene,1,1'-(chloroethenylidene)bis[4-bromo- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 26204-09-1 | Molecular Weight | 372.48200 | |
| Density | 1.662g/cm3 | Boiling Point | 410.4ºC at 760mmHg | |
| Molecular Formula | C14H9Br2Cl | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.6ºC | |
| Name | 1,1-bis-(4-bromo-phenyl)-2-chloro-ethene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.662g/cm3 |
|---|---|
| Boiling Point | 410.4ºC at 760mmHg |
| Molecular Formula | C14H9Br2Cl |
| Molecular Weight | 372.48200 |
| Flash Point | 228.6ºC |
| Exact Mass | 369.87600 |
| LogP | 5.83960 |
| Vapour Pressure | 1.44E-06mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | AXTBYHYFPDBJJS-UHFFFAOYSA-N |
| SMILES | ClC=C(c1ccc(Br)cc1)c1ccc(Br)cc1 |
|
~%
Benzene,1,1'-(c... CAS#:26204-09-1 |
| Literature: Brand; Kruecke-Amelung Chemische Berichte, 1939 , vol. 72, p. 1029,1034 |
|
~%
Benzene,1,1'-(c... CAS#:26204-09-1 |
| Literature: Patai; Bergmann Journal of the American Chemical Society, 1950 , vol. 72, p. 1034 |
|
~%
Benzene,1,1'-(c... CAS#:26204-09-1 |
| Literature: Brand; Kruecke-Amelung Chemische Berichte, 1939 , vol. 72, p. 1029,1034 |
|
~%
Benzene,1,1'-(c... CAS#:26204-09-1 |
| Literature: Brand; Kruecke-Amelung Chemische Berichte, 1939 , vol. 72, p. 1029,1034 |
| 1,1-Bis-p-bromphenyl-2-chlorethylen |