1,2-bis(4-bromophenyl)ethyne structure
|
Common Name | 1,2-bis(4-bromophenyl)ethyne | ||
|---|---|---|---|---|
| CAS Number | 2789-89-1 | Molecular Weight | 336.021 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 383.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C14H8Br2 | Melting Point | 182ºC | |
| MSDS | N/A | Flash Point | 217.2±23.0 °C | |
| Name | 1-bromo-4-[2-(4-bromophenyl)ethynyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.6±27.0 °C at 760 mmHg |
| Melting Point | 182ºC |
| Molecular Formula | C14H8Br2 |
| Molecular Weight | 336.021 |
| Flash Point | 217.2±23.0 °C |
| Exact Mass | 333.899261 |
| LogP | 6.32 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | FJQGIJIHOXZMMJ-UHFFFAOYSA-N |
| SMILES | Brc1ccc(C#Cc2ccc(Br)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2903999090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4'-Dibromotolan |
| 1,1'-(1,2-Ethynediyl)bis(4-bromobenzene) |
| 4,4'-bis(bromophenyl)acetylene |
| 1,2-bis(4-bromophenyl)ethyne |
| Bis-(4-bromophenyl acetylene) |
| 1-bromo-4-[(4-bromophenyl)ethynyl]benzene |
| 4,4'-Dibromodiphenylacetylene |
| 1,1'-Ethyne-1,2-diylbis(4-bromobenzene) |
| 1,2-bis(4-bromophenyl)acetylene |
| Bis(4-bromophenyl)acetylene |